N-(3-oxobutanoyl)pyridine-2-carboxamide
N-(3-oxobutanoyl)pyridine-2-carboxamide structure
|
Common Name | N-(3-oxobutanoyl)pyridine-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 82437-55-6 | Molecular Weight | 206.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-oxobutanoyl)pyridine-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H10N2O3 |
|---|---|
| Molecular Weight | 206.19800 |
| Exact Mass | 206.06900 |
| PSA | 79.62000 |
| LogP | 1.15740 |
| InChIKey | ZTAMCHPWFDCPGF-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)NC(=O)c1ccccn1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~75%
N-(3-oxobutanoy... CAS#:82437-55-6 |
| Literature: Sato, Masayuki; Kanuma, Norio; Kato, Tetsuzo Chemical & Pharmaceutical Bulletin, 1982 , vol. 30, # 4 p. 1315 - 1321 |
|
~70%
N-(3-oxobutanoy... CAS#:82437-55-6 |
| Literature: Yamamoto, Yutaka; Ohnishi, Shuhei; Azuma, Yutaka Chemical & Pharmaceutical Bulletin, 1982 , vol. 30, # 10 p. 3505 - 3512 |
|
~23%
N-(3-oxobutanoy... CAS#:82437-55-6 |
| Literature: Sato, Masayuki; Kanuma, Norio; Kato, Tetsuzo Chemical & Pharmaceutical Bulletin, 1982 , vol. 30, # 4 p. 1315 - 1321 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-acetoacetylpicolinamide |
| 2-Pyridinecarboxamide,N-(1,3-dioxobutyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 82437-55-6? |
| A: Chinese name of 82437-55-6 is 82437-55-6. |
| Q: What are the upstream materials of N-(3-oxobutanoyl)pyridine-2-carboxamide? |
| A: Related upstream materials(CAS) of N-(3-oxobutanoyl)pyridine-2-carboxamide: 1452-77-3;5394-63-8;85920-63-4. |
| Q: What is the molecular formula of N-(3-oxobutanoyl)pyridine-2-carboxamide? |
| A: Molecular formula of N-(3-oxobutanoyl)pyridine-2-carboxamide is C10H10N2O3. |
| Q: What is the SMILES notation of N-(3-oxobutanoyl)pyridine-2-carboxamide? |
| A: SMILES notation of N-(3-oxobutanoyl)pyridine-2-carboxamide is CC(=O)CC(=O)NC(=O)c1ccccn1. |
| Q: What is the LogP of N-(3-oxobutanoyl)pyridine-2-carboxamide? |
| A: LogP of N-(3-oxobutanoyl)pyridine-2-carboxamide is 1.15740. |
| Q: What is the polar surface area (PSA) of N-(3-oxobutanoyl)pyridine-2-carboxamide? |
| A: Polar surface area (PSA) of N-(3-oxobutanoyl)pyridine-2-carboxamide is 79.62000. |
| Q: What is the English name of N-(3-oxobutanoyl)pyridine-2-carboxamide? |
| A: The English name of N-(3-oxobutanoyl)pyridine-2-carboxamide is N-(3-oxobutanoyl)pyridine-2-carboxamide. |
| Q: What is the molecular weight of N-(3-oxobutanoyl)pyridine-2-carboxamide? |
| A: Molecular weight of N-(3-oxobutanoyl)pyridine-2-carboxamide is 206.19800. |
| Q: What is the InChIKey of N-(3-oxobutanoyl)pyridine-2-carboxamide? |
| A: InChIKey of N-(3-oxobutanoyl)pyridine-2-carboxamide is ZTAMCHPWFDCPGF-UHFFFAOYSA-N. |
| Q: What is the CAS number of N-(3-oxobutanoyl)pyridine-2-carboxamide? |
| A: CAS number of N-(3-oxobutanoyl)pyridine-2-carboxamide is 82437-55-6. |