2'-Methoxy[1,1'-biphenyl]-4-amine hydrochloride structure
|
Common Name | 2'-Methoxy[1,1'-biphenyl]-4-amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 824414-16-6 | Molecular Weight | 235.70900 | |
| Density | N/A | Boiling Point | 344.8ºC at 760 mmHg | |
| Molecular Formula | C13H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.3ºC | |
| Name | 4-(2-methoxyphenyl)aniline,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 344.8ºC at 760 mmHg |
|---|---|
| Molecular Formula | C13H14ClNO |
| Molecular Weight | 235.70900 |
| Flash Point | 162.3ºC |
| Exact Mass | 235.07600 |
| PSA | 35.25000 |
| LogP | 4.32760 |
| InChIKey | BGCLWXKDAGQQTG-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-c1ccc(N)cc1.Cl |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2'-Methoxy-biphenyl-4-ylamine hydrochloride |
| 2'-methoxy-biphenyl-4-ylamine hcl salt |
| OR7449 |