N1,N6-Bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine compound with 4-(4,6-dichloro-1,3,5-triazin-2-yl)morpholine(Poly) structure
|
Common Name | N1,N6-Bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine compound with 4-(4,6-dichloro-1,3,5-triazin-2-yl)morpholine(Poly) | ||
|---|---|---|---|---|
| CAS Number | 82451-48-7 | Molecular Weight | 629.751 | |
| Density | N/A | Boiling Point | 478.5ºC at 760mmHg | |
| Molecular Formula | C31H58Cl2N8O | Melting Point | 110-130ºC | |
| MSDS | N/A | Flash Point | 246.8ºC | |
| Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine,4-(4,6-dichloro-1,3,5-triazin-2-yl)morpholine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 478.5ºC at 760mmHg |
|---|---|
| Melting Point | 110-130ºC |
| Molecular Formula | C31H58Cl2N8O |
| Molecular Weight | 629.751 |
| Flash Point | 246.8ºC |
| Exact Mass | 628.411072 |
| PSA | 99.26000 |
| LogP | 6.86380 |
| InChIKey | JSOQEHPVNDFMMV-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(NCCCCCCNC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1.Clc1nc(Cl)nc(N2CCOCC2)n1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R20 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
| RTECS | MO1229250 |
| 1,6-Hexanediamine, N,N-bis(2,2,6,6-tetramethyl-4-piperidinyl)-, compd. with 4-(4,6-dichloro-1,3,5-triazin-2-yl)morpholine (1:1) |
| MFCD00197892 |
| N,N'-Bis(2,2,6,6-tetramethyl-4-piperidinyl)-1,6-hexanediamine - 2,4-dichloro-6-(4-morpholinyl)-1,3,5-triazine (1:1) |