bis[2-(4-methoxyphenyl)ethynyl]mercury structure
|
Common Name | bis[2-(4-methoxyphenyl)ethynyl]mercury | ||
|---|---|---|---|---|
| CAS Number | 82490-23-1 | Molecular Weight | 462.89300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14HgO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bis[2-(4-methoxyphenyl)ethynyl]mercury |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14HgO2 |
|---|---|
| Molecular Weight | 462.89300 |
| Exact Mass | 464.07000 |
| PSA | 18.46000 |
| LogP | 3.10450 |
| InChIKey | WDTPPLBFEZVKFL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C#C[Hg]C#Cc2ccc(OC)cc2)cc1 |
|
~%
bis[2-(4-methox... CAS#:82490-23-1 |
| Literature: Johnson; McEwen Journal of the American Chemical Society, 1926 , vol. 48, p. 476 |
|
~%
bis[2-(4-methox... CAS#:82490-23-1 |
| Literature: Johnson; McEwen Journal of the American Chemical Society, 1926 , vol. 48, p. 476 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| bis-(para-methoxyphenylethinyl)-quecksilber |
| 4-ethynyl-anisole,mercury (II)-compound |
| Di-(4-methoxyphenyl)-acetylen-quecksilber |
| Mercury,bis[(4-methoxyphenyl)ethynyl] |
| 4-Aethinyl-anisol,Quecksilber(II)-Verbindung |
| bis(p-methoxyphenylethynyl)mercury |