2-Trichloromethyl-4-cyano-1,3,6,9b-tetraazaphenalene structure
|
Common Name | 2-Trichloromethyl-4-cyano-1,3,6,9b-tetraazaphenalene | ||
|---|---|---|---|---|
| CAS Number | 82501-05-1 | Molecular Weight | 312.54200 | |
| Density | 1.74g/cm3 | Boiling Point | 396.4ºC at 760 mmHg | |
| Molecular Formula | C11H4Cl3N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.6ºC | |
| Name | 2-Trichloromethyl-4-cyano-1,3,6,9b-tetraazaphenalene |
|---|
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 396.4ºC at 760 mmHg |
| Molecular Formula | C11H4Cl3N5 |
| Molecular Weight | 312.54200 |
| Flash Point | 193.6ºC |
| Exact Mass | 310.95300 |
| PSA | 66.87000 |
| LogP | 2.97588 |
| Index of Refraction | 1.776 |
| InChIKey | MOHZQCNWWKCUKT-UHFFFAOYSA-N |
| SMILES | N#CC1=CN=C2C=CC=C3N=C(C(Cl)(Cl)Cl)N=C1N32 |
|
~64%
2-Trichlorometh... CAS#:82501-05-1 |
| Literature: Shaw, John T.; Coffindaffer, Timothy W.; Stimmel, Julie B.; Lindley, Patricia M. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 357 - 361 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |