N-Methyl-N-(5-methyl-1,3,4,6,9b-pentaazaphenalen-2-yl)amine structure
|
Common Name | N-Methyl-N-(5-methyl-1,3,4,6,9b-pentaazaphenalen-2-yl)amine | ||
|---|---|---|---|---|
| CAS Number | 82501-08-4 | Molecular Weight | 214.22700 | |
| Density | 1.52g/cm3 | Boiling Point | 351.7ºC at 760 mmHg | |
| Molecular Formula | C10H10N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.5ºC | |
| Name | nsc374348 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 351.7ºC at 760 mmHg |
| Molecular Formula | C10H10N6 |
| Molecular Weight | 214.22700 |
| Flash Point | 166.5ºC |
| Exact Mass | 214.09700 |
| PSA | 68.00000 |
| LogP | 1.09560 |
| Index of Refraction | 1.794 |
| InChIKey | NYISXPWKXKIXMJ-UHFFFAOYSA-N |
| SMILES | CN=c1nc2n3c(cccc3n1)NC(C)=N2 |
|
~80%
N-Methyl-N-(5-m... CAS#:82501-08-4 |
| Literature: Shaw, John T.; Coffindaffer, Timothy W.; Stimmel, Julie B.; Lindley, Patricia M. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 357 - 361 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,5-Dimethyl-1,3,4,6,9b-pentaazaphenalen-2-amine |