2-trichloromethyl-5-methyl-1,3,4,6,9b-pentaazaphenalene structure
|
Common Name | 2-trichloromethyl-5-methyl-1,3,4,6,9b-pentaazaphenalene | ||
|---|---|---|---|---|
| CAS Number | 82501-04-0 | Molecular Weight | 302.54700 | |
| Density | 1.77g/cm3 | Boiling Point | 360.3ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl3N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.7ºC | |
| Name | 2-trichloromethyl-5-methyl-1,3,4,6,9b-pentaazaphenalene |
|---|
| Density | 1.77g/cm3 |
|---|---|
| Boiling Point | 360.3ºC at 760 mmHg |
| Molecular Formula | C10H6Cl3N5 |
| Molecular Weight | 302.54700 |
| Flash Point | 171.7ºC |
| Exact Mass | 300.96900 |
| PSA | 55.97000 |
| LogP | 2.80760 |
| Index of Refraction | 1.778 |
| InChIKey | RIPUPINEUIGYCG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC=CC3=NC(C(Cl)(Cl)Cl)=NC(=N1)N23 |
|
~48%
2-trichlorometh... CAS#:82501-04-0 |
| Literature: Shaw, John T.; Coffindaffer, Timothy W.; Stimmel, Julie B.; Lindley, Patricia M. Journal of Heterocyclic Chemistry, 1982 , vol. 19, p. 357 - 361 |
| Precursor 2 | |
|---|---|
| DownStream 9 | |