(2S)-2-[(3R,5R,9R,10R,13S,14S,17S)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid structure
|
Common Name | (2S)-2-[(3R,5R,9R,10R,13S,14S,17S)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 82509-40-8 | Molecular Weight | 456.70000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H48O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (2S)-2-[(3R,5R,9R,10R,13S,14S,17S)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid3α-Hydroxytirucalla-7,24-dien-21-oic acid is a tirucallane triterpene isolated from the oleoresin of Protium hebetatum Daly[1]. |
| Name | (2S)-2-[(3R,5R,9R,10R,13S,14S,17S)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-6-methylhept-5-enoic acid |
|---|
| Description | 3α-Hydroxytirucalla-7,24-dien-21-oic acid is a tirucallane triterpene isolated from the oleoresin of Protium hebetatum Daly[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C30H48O3 |
|---|---|
| Molecular Weight | 456.70000 |
| Exact Mass | 456.36000 |
| PSA | 57.53000 |
| LogP | 7.39970 |
| InChIKey | CGPBVNAIDFBRJG-HVGLGGOPSA-N |
| SMILES | CC(C)=CCCC(C(=O)O)C1CCC2(C)C3=CCC4C(C)(C)C(O)CCC4(C)C3CCC12C |
| Precursor 0 | |
|---|---|
| DownStream 3 | |