Beta-Elemonic acid structure
|
Common Name | Beta-Elemonic acid | ||
|---|---|---|---|---|
| CAS Number | 28282-25-9 | Molecular Weight | 454.684 | |
| Density | 1.07 | Boiling Point | 565.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C30H46O3 | Melting Point | 216-219 ºC | |
| MSDS | Chinese USA | Flash Point | 309.6±26.6 °C | |
Use of Beta-Elemonic acidβ-Elemonic acid is a triterpene isolated from Boswellia papyrifera. β-Elemonic acid induces cell apoptosis, reactive oxygen species (ROS) and COX-2 expression and inhibits prolyl endopeptidase. β-Elemonic acid exhibits anticancer and anti-inflammatory effects[1][2]. |
| Name | β-Elemonic acid |
|---|---|
| Synonym | More Synonyms |
| Description | β-Elemonic acid is a triterpene isolated from Boswellia papyrifera. β-Elemonic acid induces cell apoptosis, reactive oxygen species (ROS) and COX-2 expression and inhibits prolyl endopeptidase. β-Elemonic acid exhibits anticancer and anti-inflammatory effects[1][2]. |
|---|---|
| Related Catalog | |
| Target |
COX-2 |
| In Vitro | β-elemonic acid (1, 3, 10, 20 µM; 24 hours) strongly induces human A549 lung cancer cell apoptosis in a dose- and time-dependent manner[1]. β-elemonic acid (1, 3, 10, 20 µM; 24 hours) exerts potent cytotoxic effects on human NSCLC A549 cells in a dose-dependent manner. The IC50 value following a 24-h exposure to β-elemonic acid was 6.92 µM[1]. β-elemonic acid (20 µM; 24 hours) results in a cell percentage of 58.01% in the G0/G1 phase[1]. β-elemonic acid (1, 3, 10, 20 µM; 24 hours) inhibits phosphorylation of p42/44, MAPK/JNK and p38 in the A549 cells[1]. |
| References |
| Density | 1.07 |
|---|---|
| Boiling Point | 565.2±50.0 °C at 760 mmHg |
| Melting Point | 216-219 ºC |
| Molecular Formula | C30H46O3 |
| Molecular Weight | 454.684 |
| Flash Point | 309.6±26.6 °C |
| Exact Mass | 454.344696 |
| PSA | 54.37000 |
| LogP | 8.56 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | XLPAINGDLCDYQV-UHFFFAOYSA-N |
| SMILES | CC(C)=CCCC(C(=O)O)C1CCC2(C)C3=C(CCC12C)C1(C)CCC(=O)C(C)(C)C1CC3 |
| Storage condition | -20℃ |
| RIDADR | NONH for all modes of transport |
|---|
|
~%
Beta-Elemonic acid CAS#:28282-25-9 |
| Literature: Ruzicka et al. Helvetica Chimica Acta, 1943 , vol. 26, p. 1659,1664 |
|
Name: Cytotoxicity against human CaSKi cells after 6 days by MTT assay
Source: ChEMBL
Target: Ca-Ski
External Id: CHEMBL979628
|
|
Name: Cytotoxicity against human SiHa cells after 6 days by MTT assay
Source: ChEMBL
Target: SiHa
External Id: CHEMBL979627
|
|
Name: Cytotoxicity against human T24 cells after 6 days by MTT assay
Source: ChEMBL
Target: T-24
External Id: CHEMBL979624
|
|
Name: Cytotoxicity against human PLC/PRF/5 cells after 6 days by MTT assay
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL979623
|
|
Name: Cytotoxicity against human HT3 cells after 6 days by MTT assay
Source: ChEMBL
Target: HT-3
External Id: CHEMBL979626
|
|
Name: Cytotoxicity against mouse 212 cells after 6 days by MTT assay
Source: ChEMBL
Target: NON-PROTEIN TARGET
External Id: CHEMBL979625
|
| (5β,13α,14β,20S)-3-Oxolanosta-8,24-dien-21-oic acid |
| (2S)-6-methyl-2-[(10S,14S,17S)-4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,7,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]hept-5-enoic acid |
| beta-Elemonic acid |