2-(2,2,2-trichloroethyl)thiolane 1,1-dioxide structure
|
Common Name | 2-(2,2,2-trichloroethyl)thiolane 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 82639-78-9 | Molecular Weight | 251.55800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H9Cl3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2,2,2-trichloroethyl)thiolane 1,1-dioxide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H9Cl3O2S |
|---|---|
| Molecular Weight | 251.55800 |
| Exact Mass | 249.93900 |
| PSA | 42.52000 |
| LogP | 3.40470 |
| InChIKey | LENCAMHFOHOJSD-UHFFFAOYSA-N |
| SMILES | O=S1(=O)CCCC1CC(Cl)(Cl)Cl |
|
~87%
2-(2,2,2-trichl... CAS#:82639-78-9 |
| Literature: Bougeard,P.; Bury,A.; Cooksey,C.J. Journal of the American Chemical Society, 1982 , vol. 104, p. 5230 |
|
~%
2-(2,2,2-trichl... CAS#:82639-78-9 |
| Literature: Ashcroft, Martyn M.; Bougeard, Peter; Bury, Adrian; Cooksey, Christopher J.; Johnson, Michael D.; et al. Journal of Organic Chemistry, 1984 , vol. 49, # 10 p. 1751 - 1761 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Thiophene,tetrahydro-2-(2,2,2-trichloroethyl)-,1,1-dioxide |
| LENCAMHFOHOJSD-UHFFFAOYSA |
| 2-(2,2,2-trichloro-ethyl)-sulfolane |
| InChI=1/C6H9Cl3O2S/c7-6(8,9)4-5-2-1-3-12(5,10)11/h5H,1-4H2 |