methyl 2-[dimethyl(phenyl)silyl]but-3-enoate structure
|
Common Name | methyl 2-[dimethyl(phenyl)silyl]but-3-enoate | ||
|---|---|---|---|---|
| CAS Number | 82654-01-1 | Molecular Weight | 234.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[dimethyl(phenyl)silyl]but-3-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18O2Si |
|---|---|
| Molecular Weight | 234.36600 |
| Exact Mass | 234.10800 |
| PSA | 26.30000 |
| LogP | 2.33120 |
| InChIKey | MBAHQZSGXZJGHL-UHFFFAOYSA-N |
| SMILES | C=CC(C(=O)OC)[Si](C)(C)c1ccccc1 |
|
~72%
methyl 2-[dimet... CAS#:82654-01-1 |
| Literature: Uno, Hidemitsu Bulletin of the Chemical Society of Japan, 1986 , vol. 59, # 8 p. 2471 - 2480 |
|
~%
methyl 2-[dimet... CAS#:82654-01-1 |
| Literature: Uno, Hidemitsu Bulletin of the Chemical Society of Japan, 1986 , vol. 59, # 8 p. 2471 - 2480 |
| methyl 2-dimethylphenylsilyl-3-butenoate |
| 3-Butenoic acid,2-(dimethylphenylsilyl)-,methyl ester |