N-(3-aminophenyl)-N,4-dimethylbenzenesulfonamide structure
|
Common Name | N-(3-aminophenyl)-N,4-dimethylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 82670-10-8 | Molecular Weight | 276.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-aminophenyl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16N2O2S |
|---|---|
| Molecular Weight | 276.35400 |
| Exact Mass | 276.09300 |
| PSA | 71.78000 |
| LogP | 4.06430 |
| InChIKey | ZHDHTGCVPGZFGP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2cccc(N)c2)cc1 |
|
~%
N-(3-aminopheny... CAS#:82670-10-8 |
| Literature: Morgan; Micklethwait Journal of the Chemical Society, 1912 , vol. 101, p. 145 |
|
~%
N-(3-aminopheny... CAS#:82670-10-8 |
| Literature: Shinkai; Ishikawa; Manabe Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 6 p. 1694 - 1699 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| N-methyl-N-tosyl-m-phenylenediamine |
| N-p-Toluolsulfonyl-N-methyl-m-phenylendiamin |
| Benzenesulfonamide,N-(3-aminophenyl)-N,4-dimethyl |
| Toluol-4-sulfonsaeure-(3-amino-N-methyl-anilid) |
| toluene-4-sulfonic acid-(3-amino-N-methyl-anilide) |