Benzenesulfonamide,N,4-dimethyl-N-(3-nitrophenyl)- structure
|
Common Name | Benzenesulfonamide,N,4-dimethyl-N-(3-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6380-15-0 | Molecular Weight | 306.33700 | |
| Density | 1.36g/cm3 | Boiling Point | 465.7ºC at 760 mmHg | |
| Molecular Formula | C14H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.5ºC | |
| Name | N,4-dimethyl-N-(3-nitrophenyl)benzenesulfonamide |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 465.7ºC at 760 mmHg |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.33700 |
| Flash Point | 235.5ºC |
| Exact Mass | 306.06700 |
| PSA | 91.58000 |
| LogP | 4.33230 |
| Index of Refraction | 1.623 |
| InChIKey | GIZAKCFKYXAIAU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2cccc([N+](=O)[O-])c2)cc1 |
|
~94%
Benzenesulfonam... CAS#:6380-15-0 |
| Literature: Shinkai; Ishikawa; Manabe Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 6 p. 1694 - 1699 |
|
~%
Benzenesulfonam... CAS#:6380-15-0 |
| Literature: Morgan; Micklethwait Journal of the Chemical Society, 1912 , vol. 101, p. 145 |