1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-trimethyl- structure
|
Common Name | 1,3,5-Triazine-2,4,6(1H,3H,5H)-trione,1,3,5-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 827-16-7 | Molecular Weight | 171.15400 | |
| Density | 1.325g/cm3 | Boiling Point | 274ºC at 760 mmHg | |
| Molecular Formula | C6H9N3O3 | Melting Point | 176.5 °C | |
| MSDS | N/A | Flash Point | 122.4ºC | |
| Name | 1,3,5-trimethyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 274ºC at 760 mmHg |
| Melting Point | 176.5 °C |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.15400 |
| Flash Point | 122.4ºC |
| Exact Mass | 171.06400 |
| PSA | 66.00000 |
| Index of Refraction | 1.516 |
| InChIKey | AHWDQDMGFXRVFB-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)n(C)c(=O)n(C)c1=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933699090 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| trimethylcyanuric acid |
| Trimethyl isocyanurate |
| 1,3,5-trimethyl 2,4,6-trioxohexahydro-1,3,5-triazine |
| 1,3,5-trimethyl-2,4,6-trioxohexahydro-S-triazine |
| Methyl isocyanate trimer |
| HMS1661F11 |
| Isocyanuric acid,trimethyl ester |