Sodium 2,4-dimethylbenzenesulfonate
Sodium 2,4-dimethylbenzenesulfonate structure
|
Common Name | Sodium 2,4-dimethylbenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 827-21-4 | Molecular Weight | 208.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9NaO3S | Melting Point | 112-116 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Sodium 2,4-dimethylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | 112-116 °C(lit.) |
|---|---|
| Molecular Formula | C8H9NaO3S |
| Molecular Weight | 208.21000 |
| Exact Mass | 208.01700 |
| PSA | 65.58000 |
| LogP | 2.28830 |
| InChIKey | GJQXYSKWRDJNAJ-UHFFFAOYSA-M |
| SMILES | Cc1ccc(S(=O)(=O)[O-])c(C)c1.[Na+] |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2,4-dimethylbenzenesulfonic acid sodium salt |
| 2,4-Dimethylbenzenesulfonic |
| SODIUM M-XYLENE-4-SULFONATE |
| sodium m-xylenesulfonate |
| 2,4-dimethyl-benzenesulfonicacisodiumsalt |
| SODIUM2,4-DIMETHYLBENZENESULPHONATE |
| m-xylene-4-sulphonic acid sodium salt |
| EINECS 212-567-3 |
| sodium m-xylene-4-sulphonate |
| sodium 2,4-xylene sulfonate |
| MFCD00041883 |
| M-XYLENE-4-SULFONIC ACID SODIUM SALT |
| XYLENESULFONATE,SODIUMSALT |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Sodium 2,4-dimethylbenzenesulfonate? |
| A: Molecular formula of Sodium 2,4-dimethylbenzenesulfonate is C8H9NaO3S. |
| Q: What is the molecular weight of Sodium 2,4-dimethylbenzenesulfonate? |
| A: Molecular weight of Sodium 2,4-dimethylbenzenesulfonate is 208.21000. |
| Q: What is the English name of Sodium 2,4-dimethylbenzenesulfonate? |
| A: The English name of Sodium 2,4-dimethylbenzenesulfonate is Sodium 2,4-dimethylbenzenesulfonate. |
| Q: What is the safety information for Sodium 2,4-dimethylbenzenesulfonate? |
| A: Safety information for Sodium 2,4-dimethylbenzenesulfonate: S24/25. |
| Q: What is the SMILES notation of Sodium 2,4-dimethylbenzenesulfonate? |
| A: SMILES notation of Sodium 2,4-dimethylbenzenesulfonate is Cc1ccc(S(=O)(=O)[O-])c(C)c1.[Na+]. |
| Q: What is the CAS number of Sodium 2,4-dimethylbenzenesulfonate? |
| A: CAS number of Sodium 2,4-dimethylbenzenesulfonate is 827-21-4. |
| Q: What is the polar surface area (PSA) of Sodium 2,4-dimethylbenzenesulfonate? |
| A: Polar surface area (PSA) of Sodium 2,4-dimethylbenzenesulfonate is 65.58000. |
| Q: What is the LogP of Sodium 2,4-dimethylbenzenesulfonate? |
| A: LogP of Sodium 2,4-dimethylbenzenesulfonate is 2.28830. |
| Q: What is the InChIKey of Sodium 2,4-dimethylbenzenesulfonate? |
| A: InChIKey of Sodium 2,4-dimethylbenzenesulfonate is GJQXYSKWRDJNAJ-UHFFFAOYSA-M. |
| Q: What English synonyms does Sodium 2,4-dimethylbenzenesulfonate have? |
| A: English synonyms of Sodium 2,4-dimethylbenzenesulfonate: 2,4-dimethylbenzenesulfonic acid sodium salt, 2,4-Dimethylbenzenesulfonic, SODIUM M-XYLENE-4-SULFONATE, sodium m-xylenesulfonate, 2,4-dimethyl-benzenesulfonicacisodiumsalt, SODIUM2,4-DIMETHYLBENZENESULPHONATE, m-xylene-4-sulphonic acid sodium salt, EINECS 212-567-3, sodium m-xylene-4-sulphonate, sodium 2,4-xylene sulfonate, MFCD00041883, M-XYLENE-4-SULFONIC ACID SODIUM SALT, XYLENESULFONATE,SODIUMSALT. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |