2,4-Dibromo-6-nitroaniline structure
|
Common Name | 2,4-Dibromo-6-nitroaniline | ||
|---|---|---|---|---|
| CAS Number | 827-23-6 | Molecular Weight | 295.91600 | |
| Density | 2.177 g/cm3 | Boiling Point | 328.6ºC at 760 mmHg | |
| Molecular Formula | C6H4Br2N2O2 | Melting Point | 128-130 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 152.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4-Dibromo-6-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 2.177 g/cm3 |
|---|---|
| Boiling Point | 328.6ºC at 760 mmHg |
| Melting Point | 128-130 °C(lit.) |
| Molecular Formula | C6H4Br2N2O2 |
| Molecular Weight | 295.91600 |
| Flash Point | 152.5ºC |
| Exact Mass | 293.86400 |
| PSA | 71.84000 |
| LogP | 3.80640 |
| Index of Refraction | 1.697 |
| InChIKey | OBTUHOVIVLDLLD-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc(Br)cc1[N+](=O)[O-] |
| Storage condition | 2-8℃ |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H312 + H332-H315-H319-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenamine,2,4-dibromo-6-nitro |
| 2-nitro-4,6-dibromoaniline |
| MFCD00012107 |
| 2,4-dibromo-6-nitrophenylamine |
| 2,3-O-ISOPROPYLIDENE-D-ERYTHRONOLACTONE |
| 2,4-Dibrom-6-nitro-anilin |
| 2,4-dibromo-6-nitro-benzenamine |
| 2,4-dibromo-6-nitro-aniline |
| 4,6-dibromo-2-nitrobenzenamine |
| 4,6-dibromo-2-nitroaniline |