Abz-Gly-Ile-Val-Arg-Ala-Lys(Dnp)-OH structure
|
Common Name | Abz-Gly-Ile-Val-Arg-Ala-Lys(Dnp)-OH | ||
|---|---|---|---|---|
| CAS Number | 827044-38-2 | Molecular Weight | 928.00 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C41H61N13O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Abz-Gly-Ile-Val-Arg-Ala-Lys(Dnp)-OHAbz-GIVRAK(Dnp) is the most efficient substrate for cathepsin B and is highly selective for this enzyme among lysosomal cysteine proteases. After Abz-GIVRAK(Dnp) is hydrolyzed, aminoacylbenziminosulfosuccinic acid (Abz-SAS) is released, and dinitrobenzoyl (Dnp) is also released. The product of this hydrolysis reaction, Abz-SAS, is fluorescent under ultraviolet light and can emit a fluorescent signal[1]. |
| Name | Abz-Gly-Ile-Val-Arg-Ala-Lys(Dnp)-OH |
|---|
| Description | Abz-GIVRAK(Dnp) is the most efficient substrate for cathepsin B and is highly selective for this enzyme among lysosomal cysteine proteases. After Abz-GIVRAK(Dnp) is hydrolyzed, aminoacylbenziminosulfosuccinic acid (Abz-SAS) is released, and dinitrobenzoyl (Dnp) is also released. The product of this hydrolysis reaction, Abz-SAS, is fluorescent under ultraviolet light and can emit a fluorescent signal[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C41H61N13O12 |
|---|---|
| Molecular Weight | 928.00 |
| Exact Mass | 927.45600 |
| PSA | 403.49000 |
| LogP | 5.82820 |
| InChIKey | SVDPRCWUGMJJJZ-PLPDKLJWSA-N |
| SMILES | CCC(C)C(NC(=O)CNC(=O)c1ccccc1N)C(=O)NC(C(=O)NC(CCCN=C(N)N)C(=O)NC(C)C(=O)NC(CCCCNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)O)C(C)C |