1-Sulfobutyl-3-Methylimidazolium hydrogen sulfate structure
|
Common Name | 1-Sulfobutyl-3-Methylimidazolium hydrogen sulfate | ||
|---|---|---|---|---|
| CAS Number | 827320-59-2 | Molecular Weight | 316.35200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H16N2O7S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-Sulfobutyl)-3-Methylimidazolium Hydrogen Sulfate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H16N2O7S2 |
|---|---|
| Molecular Weight | 316.35200 |
| Exact Mass | 316.04000 |
| PSA | 175.09000 |
| LogP | 0.71130 |
| Index of Refraction | 1.50 |
| InChIKey | IEKJIBPFXKAASL-UHFFFAOYSA-N |
| SMILES | C[n+]1ccn(CCCCS(=O)(=O)O)c1.O=S(=O)([O-])O |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hydrogen sulfate,4-(3-methylimidazol-3-ium-1-yl)butane-1-sulfonic acid |