1-Ethyl-3-methylimidazolium hydrogen sulfate structure
|
Common Name | 1-Ethyl-3-methylimidazolium hydrogen sulfate | ||
|---|---|---|---|---|
| CAS Number | 412009-61-1 | Molecular Weight | 208.236 | |
| Density | 1.367 | Boiling Point | N/A | |
| Molecular Formula | C6H12N2O4S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 1-Ethyl-3-methylimidazolium Hydrogen Sulfate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367 |
|---|---|
| Molecular Formula | C6H12N2O4S |
| Molecular Weight | 208.236 |
| Exact Mass | 208.051773 |
| PSA | 94.62000 |
| LogP | 0.41790 |
| Index of Refraction | 1.5316 (30℃) |
| InChIKey | HZKDSQCZNUUQIF-UHFFFAOYSA-M |
| SMILES | CCn1cc[n+](C)c1.O=S(=O)([O-])O |
| Storage condition | 2-8℃ |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD06798195 |
| 1-Ethyl-3-methylimidazolium hydrogen sulfate |
| 1-ETHYL-3-METHYLIMIDAZOLIUM HYDROGENSULFATE |
| 1-Ethyl-3-methyl-1H-imidazol-3-ium hydrogen sulfate |