CS-0777 structure
|
Common Name | CS-0777 | ||
|---|---|---|---|---|
| CAS Number | 827344-05-8 | Molecular Weight | 342.47500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CS-0777A potent, selective, orally active S1P receptor-1 (S1P1) agonist with EC50 of 1.1 nM, 320-fold selectivity over S1P3. |
| Name | 1-{5-[(3R)-3-amino-4-hydroxy-3-methylbutyl]-1-methyl-1H-pyrrol-2-yl}-4-(4-methylphenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H30N2O2 |
|---|---|
| Molecular Weight | 342.47500 |
| Exact Mass | 342.23100 |
| PSA | 68.25000 |
| LogP | 3.88170 |
| InChIKey | YXEQXPNSBUIRDZ-OAQYLSRUSA-N |
| SMILES | Cc1ccc(CCCC(=O)c2ccc(CCC(C)(N)CO)n2C)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| (2R)-2-amino-2-methyl-4-{1-methyl-5-[4-(4-methylphenyl)butanoyl]pyrrol-2-yl}butan-1-ol |
| CS-0777 |