3-[6-[(3,4-dimethoxyphenyl)methoxyamino]purin-9-yl]propanenitrile structure
|
Common Name | 3-[6-[(3,4-dimethoxyphenyl)methoxyamino]purin-9-yl]propanenitrile | ||
|---|---|---|---|---|
| CAS Number | 827585-22-8 | Molecular Weight | 354.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[6-[(3,4-dimethoxyphenyl)methoxyamino]purin-9-yl]propanenitrile |
|---|
| Molecular Formula | C17H18N6O3 |
|---|---|
| Molecular Weight | 354.36300 |
| Exact Mass | 354.14400 |
| PSA | 107.11000 |
| LogP | 2.37388 |
| InChIKey | VKMQAKCFPKYEPL-UHFFFAOYSA-N |
| SMILES | COc1ccc(CONc2ncnc3c2ncn3CCC#N)cc1OC |
|
~58%
3-[6-[(3,4-dime... CAS#:827585-22-8 |
| Literature: Pappo, Doron; Shimony, Shiri; Kashman, Yoel Journal of Organic Chemistry, 2005 , vol. 70, # 1 p. 199 - 206 |
|
~%
3-[6-[(3,4-dime... CAS#:827585-22-8 |
| Literature: Pappo, Doron; Shimony, Shiri; Kashman, Yoel Journal of Organic Chemistry, 2005 , vol. 70, # 1 p. 199 - 206 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |