[(phenyl-pyridin-2-yl-methylidene)amino]thiourea structure
|
Common Name | [(phenyl-pyridin-2-yl-methylidene)amino]thiourea | ||
|---|---|---|---|---|
| CAS Number | 82766-13-0 | Molecular Weight | 256.32600 | |
| Density | 1.25g/cm3 | Boiling Point | 436.9ºC at 760 mmHg | |
| Molecular Formula | C13H12N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218ºC | |
| Name | [[phenyl(pyridin-2-yl)methylidene]amino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 436.9ºC at 760 mmHg |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.32600 |
| Flash Point | 218ºC |
| Exact Mass | 256.07800 |
| PSA | 95.39000 |
| LogP | 2.75840 |
| Index of Refraction | 1.662 |
| InChIKey | DJSSWOPZTQTBBW-FOWTUZBSSA-N |
| SMILES | NC(=S)NN=C(c1ccccc1)c1ccccn1 |
| HS Code | 2933990090 |
|---|
|
~90%
[(phenyl-pyridi... CAS#:82766-13-0 |
| Literature: Pingaew, Ratchanok; Prachayasittikul, Supaluk; Ruchirawat, Somsak Molecules, 2010 , vol. 15, # 2 p. 988 - 996 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2'-benzoylpyridine thiosemicarbazone |
| 2-benzoylpyridyl 3-thiosemicarbazone |
| 2-benzoylpyridine 3-thiosemicarbazone |