Antipyrine, 4- (benzylideneamino)
Antipyrine, 4- (benzylideneamino) structure
|
Common Name | Antipyrine, 4- (benzylideneamino) | ||
|---|---|---|---|---|
| CAS Number | 83-17-0 | Molecular Weight | 291.34700 | |
| Density | 1.12g/cm3 | Boiling Point | 421.1ºC at 760 mmHg | |
| Molecular Formula | C18H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 421.1ºC at 760 mmHg |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.34700 |
| Flash Point | 208.5ºC |
| Exact Mass | 291.13700 |
| PSA | 39.29000 |
| LogP | 3.23500 |
| Index of Refraction | 1.606 |
| InChIKey | DOFPFUSLGOLLCL-UHFFFAOYSA-N |
| SMILES | Cc1c(N=Cc2ccccc2)c(=O)n(-c2ccccc2)n1C |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:94-41-7
CAS#:519-98-2This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Benzylideneaminoantipyrine |
| 4-benzylideneamino-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-one |
| benzylidene-4-aminoantipyrine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one? |
| A: Boiling point of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one is 421.1ºC at 760 mmHg. |
| Q: What is the LogP of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one? |
| A: LogP of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one is 3.23500. |
| Q: What is the SMILES notation of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one? |
| A: SMILES notation of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one is Cc1c(N=Cc2ccccc2)c(=O)n(-c2ccccc2)n1C. |
| Q: What is the Chinese name of 83-17-0? |
| A: Chinese name of 83-17-0 is 83-17-0. |
| Q: What is the InChIKey of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one? |
| A: InChIKey of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one is DOFPFUSLGOLLCL-UHFFFAOYSA-N. |
| Q: What English synonyms does 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one have? |
| A: English synonyms of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one: 4-Benzylideneaminoantipyrine, 4-benzylideneamino-1,5-dimethyl-2-phenyl-1,2-dihydro-pyrazol-3-one, benzylidene-4-aminoantipyrine. |
| Q: What is the molecular weight of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one? |
| A: Molecular weight of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one is 291.34700. |
| Q: What is the English name of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one? |
| A: The English name of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one is 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one. |
| Q: What is the CAS number of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one? |
| A: CAS number of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one is 83-17-0. |
| Q: What is the polar surface area (PSA) of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one? |
| A: Polar surface area (PSA) of 4-(benzylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one is 39.29000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |