diethyl sec-butylmalonate structure
|
Common Name | diethyl sec-butylmalonate | ||
|---|---|---|---|---|
| CAS Number | 83-27-2 | Molecular Weight | 216.27400 | |
| Density | 0,98 g/cm3 | Boiling Point | 110-114°C 18mm | |
| Molecular Formula | C11H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 110-114°C/18mm | |
| Name | Diethyl 2-(sec-butyl)malonate |
|---|---|
| Synonym | More Synonyms |
| Density | 0,98 g/cm3 |
|---|---|
| Boiling Point | 110-114°C 18mm |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.27400 |
| Flash Point | 110-114°C/18mm |
| Exact Mass | 216.13600 |
| PSA | 52.60000 |
| LogP | 1.77490 |
| Index of Refraction | 1.431 |
| InChIKey | MIIZSUOEOUHAIZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)CC |
| Safety Phrases | S24/25 |
|---|---|
| HS Code | 2917190090 |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| MFCD00015194 |
| EINECS 201-463-3 |
| diethyl 2-butan-2-ylpropanedioate |