Diacetazotol
Modify Date: 2026-07-17 10:01:41
Diacetazotol structure
|
Common Name | Diacetazotol | ||
|---|---|---|---|---|
| CAS Number | 83-63-6 | Molecular Weight | 309.36200 | |
| Density | 1.11g/cm3 | Boiling Point | 547.7ºC at 760 mmHg | |
| Molecular Formula | C18H19N3O2 | Melting Point | 76ºC | |
| MSDS | N/A | Flash Point | 285.1ºC | |
Use of DiacetazotolDiacetazotol inhibits dioxin-induced ethoxyresorufin-O-deethylase (EROD) activity with IC50 of 75±4 nM. Diacetazotol extracts from patent US20070032458, compound 3. |
| Name | N-acetyl-N-[2-methyl-4-[(2-methylphenyl)diazenyl]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Description | Diacetazotol inhibits dioxin-induced ethoxyresorufin-O-deethylase (EROD) activity with IC50 of 75±4 nM. Diacetazotol extracts from patent US20070032458, compound 3. |
|---|---|
| Related Catalog | |
| Target |
IC50: 75±4 nM (Dioxin-induced EROD activity)[1] |
| In Vitro | Diacetazotol has activity for inhibiting dioxin toxicity[1]. |
| References |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 547.7ºC at 760 mmHg |
| Melting Point | 76ºC |
| Molecular Formula | C18H19N3O2 |
| Molecular Weight | 309.36200 |
| Flash Point | 285.1ºC |
| Exact Mass | 309.14800 |
| PSA | 62.10000 |
| LogP | 4.61820 |
| Index of Refraction | 1.575 |
| InChIKey | YIEDSISPYKQADU-UHFFFAOYSA-N |
| SMILES | CC(=O)N(C(C)=O)c1ccc(N=Nc2ccccc2C)cc1C |
CHEMICAL IDENTIFICATION
|
|
~%
Diacetazotol CAS#:83-63-6 |
| Literature: Kalle and Co. Patent: DE253884 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 11, p. 1177 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
Total 2, Current Page 1 of 1
1
| Dimazon |
| Pellidole |
| Diacetotoluide |
| 4'-Diacetylamino-2.3'-dimethyl-azobenzol |
| Pellidol |
| Diacetylaminoazotoluen |
| Dermagen |
| 5-o-Toluolazo-2-diacetylamino-toluol |
| Diacetazotol |
| Dermagan |
| N-(2-methyl-4-o-tolylazo-phenyl)-diacetamide |
| 4'-Diacetamino-2.3'-dimethyl-azobenzol |
| Epidermol |
| Diamazo |
| Periphermin |
| N-(2-Methyl-4-o-tolylazo-phenyl)-diacetamid |
| EINECS 201-490-0 |