1-Allyl-1H-indole-2,3-dione structure
|
Common Name | 1-Allyl-1H-indole-2,3-dione | ||
|---|---|---|---|---|
| CAS Number | 830-74-0 | Molecular Weight | 187.19500 | |
| Density | 1.233g/cm3 | Boiling Point | 321.7ºC at 760 mmHg | |
| Molecular Formula | C11H9NO2 | Melting Point | 87-90ºC | |
| MSDS | N/A | Flash Point | 146.4ºC | |
| Name | 1-prop-2-enylindole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 321.7ºC at 760 mmHg |
| Melting Point | 87-90ºC |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.19500 |
| Flash Point | 146.4ºC |
| Exact Mass | 187.06300 |
| PSA | 37.38000 |
| LogP | 1.46690 |
| Index of Refraction | 1.591 |
| InChIKey | ZWNYDPBLEDGGQD-UHFFFAOYSA-N |
| SMILES | C=CCN1C(=O)C(=O)c2ccccc21 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-allyl-1H-indole-2,3-dione |
| 1-allyl-indole-2,3-dione |
| MFCD00224218 |
| 1-allylisatin |
| N-allylindoline-2,3-dione |
| 1-allylindoline-2,3-dione |
| allylindoledione |
| N-allyl isatin |