4-chloro-2,8-di(trifluoromethyl)quinoline structure
|
Common Name | 4-chloro-2,8-di(trifluoromethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 83012-13-9 | Molecular Weight | 299.600 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 251.8±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H4ClF6N | Melting Point | 46-48 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 106.1±25.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,8-Bis(Trifluoromethyl)-4-Chloroquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 251.8±35.0 °C at 760 mmHg |
| Melting Point | 46-48 °C(lit.) |
| Molecular Formula | C11H4ClF6N |
| Molecular Weight | 299.600 |
| Flash Point | 106.1±25.9 °C |
| Exact Mass | 298.993652 |
| PSA | 12.89000 |
| LogP | 4.36 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | ZSQOESPYYNJBCZ-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(Cl)c2cccc(C(F)(F)F)c2n1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933499090 |
|
~85%
4-chloro-2,8-di... CAS#:83012-13-9 |
| Literature: Adam, Solange Tetrahedron, 1991 , vol. 47, # 36 p. 7609 - 7614 |
|
~57%
4-chloro-2,8-di... CAS#:83012-13-9 |
| Literature: Babu, Konda Ramesh; Eeshwaraiah, Begari; Aravind, Dachepally; Meshram, Harshadas M.; Raju, Rallabaldi Madhusudan; Bhattacharya, Apurba; Bandichhor, Rakeshwar Monatshefte fur Chemie, 2008 , vol. 139, # 2 p. 179 - 181 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
New quinoline derivatives: synthesis and investigation of antibacterial and antituberculosis properties.
Eur. J. Med. Chem. 45 , 3374, (2010) Four new series of quinoline derivatives were synthesized starting from 2-trifluoromethyl aniline through multi-step reactions. In the reaction sequence, substituted aniline was cyclized to 4-hydroxy ... |
| 4-chloro-2,8-di(trifluoromethyl)quinoline |
| 4-Chloro-2,8-bis(trifluoromethyl)quinoline |
| EINECS 280-132-5 |
| MFCD00075104 |
| 4-Chloro-2,8-bis-trifluoromethyl-quinoline |
| Quinoline, 4-chloro-2,8-bis(trifluoromethyl)- |