Quin II
Modify Date: 2026-07-04 10:41:01
Quin II structure
|
Common Name | Quin II | ||
|---|---|---|---|---|
| CAS Number | 83014-44-2 | Molecular Weight | 541.5 | |
| Density | 1.494g/cm3 | Boiling Point | 831.6ºC at 760 mmHg | |
| Molecular Formula | C26H27N3O10 | Melting Point | 164-166ºC | |
| MSDS | N/A | Flash Point | 456.7ºC | |
Use of Quin IIQuin II is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | quin 2 |
|---|
| Description | Quin II is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.494g/cm3 |
|---|---|
| Boiling Point | 831.6ºC at 760 mmHg |
| Melting Point | 164-166ºC |
| Molecular Formula | C26H27N3O10 |
| Molecular Weight | 541.5 |
| Flash Point | 456.7ºC |
| Exact Mass | 541.16964407 |
| PSA | 63.60000 |
| LogP | 2.89590 |
| Index of Refraction | 1.688 |
| InChIKey | XCBWMEWFFNUFLV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N(CC(=O)O)CC(=O)O)OCC2=NC3=C(C=C(C=C3C=C2)OC)N(CC(=O)O)CC(=O)O |