tert-butyl(4s)-1-methyl-2-oxoimidazolidine-4-carboxylate structure
|
Common Name | tert-butyl(4s)-1-methyl-2-oxoimidazolidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 83056-79-5 | Molecular Weight | 200.235 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 347.4±31.0 °C at 760 mmHg | |
| Molecular Formula | C9H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.9±24.8 °C | |
| Name | tert-butyl (4S)-1-methyl-2-oxoimidazolidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 347.4±31.0 °C at 760 mmHg |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.235 |
| Flash Point | 163.9±24.8 °C |
| Exact Mass | 200.116089 |
| PSA | 58.64000 |
| LogP | 0.81 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.474 |
| InChIKey | JHSLVEQWBDYFQN-LURJTMIESA-N |
| SMILES | CN1CC(C(=O)OC(C)(C)C)NC1=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~96%
tert-butyl(4s)-... CAS#:83056-79-5 |
| Literature: Tanabe Seiyaku Co., Ltd. Patent: US4508727 A1, 1985 ; US 4508727 A |
|
~%
tert-butyl(4s)-... CAS#:83056-79-5 |
| Literature: Journal of Medicinal Chemistry, , vol. 32, # 2 p. 289 - 297 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-Butyl (4S)-1-methyl-2-oxoimidazolidine-4-carboxylate |
| 2-Methyl-2-propanyl (4S)-1-methyl-2-oxo-4-imidazolidinecarboxylate |