Sultamicillin tosilate structure
|
Common Name | Sultamicillin tosilate | ||
|---|---|---|---|---|
| CAS Number | 83105-70-8 | Molecular Weight | 766.859 | |
| Density | N/A | Boiling Point | 907.7ºC at 760 mmHg | |
| Molecular Formula | C32H38N4O12S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 502.8ºC | |
Use of Sultamicillin tosilateSultamicillin (tosylate) is a potent and orally active beta-lactamase inhibitor, an antibiotic with antibacterial activity. Sultamicillin (tosylate) is the tosylate salt of the double ester of sulbactam plus ampicillin[1]. |
| Name | sultamicillin tosylate |
|---|---|
| Synonym | More Synonyms |
| Description | Sultamicillin (tosylate) is a potent and orally active beta-lactamase inhibitor, an antibiotic with antibacterial activity. Sultamicillin (tosylate) is the tosylate salt of the double ester of sulbactam plus ampicillin[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 907.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C32H38N4O12S3 |
| Molecular Weight | 766.859 |
| Flash Point | 502.8ºC |
| Exact Mass | 766.164856 |
| PSA | 278.91000 |
| LogP | 3.78170 |
| InChIKey | FFCSPKNZHGIDQM-FJEOFBQASA-N |
| SMILES | CC1(C)SC2C(NC(=O)C(N)c3ccccc3)C(=O)N2C1C(=O)OCOC(=O)C1N2C(=O)CC2S(=O)(=O)C1(C)C.Cc1ccc(S(=O)(=O)O)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2941101900 |
|---|
| HS Code | 2941101900 |
|---|
| SlutaMycillin Tosylate API |
| MFCD01682151 |
| CP 49952 p-Toluenesulfonate |
| vd1827p-toluenesulfonate |
| 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-, [[[(2S,5R,6R)-6-[[(2R)-2-amino-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-yl]carbonyl]oxy]methyl ester, 4,4-dioxide, (2S,5R)-, 4-methylbenzenesulfonate (1:1) |
| Unasyn |
| Bethacil orale |
| VD 1827 p-Toluenesulfonate |
| Unacim orale |
| Sultamicillin tosilate |
| Unacid PD oral |
| Unacim |
| ({[(2S,5R,6R)-6-{[(2R)-2-Amino-2-phenylacetyl]amino}-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-yl]carbonyl}oxy)methyl (2S,5R)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate 4,4-dioxide 4-methylbenzenesulfonate (1:1) |
| Sultamicillin Tosylate |
| sbtpc |
| Bacimex |