Acetildenafil structure
|
Common Name | Acetildenafil | ||
|---|---|---|---|---|
| CAS Number | 831217-01-7 | Molecular Weight | 466.576 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C25H34N6O3 | Melting Point | 131-133ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of AcetildenafilAcetildenafil is a derivative of the phosphodiesterase 5 (PDE5) inhibitor Sildenafil. |
| Name | 5-[2-ethoxy-5-[2-(4-ethylpiperazin-1-yl)acetyl]phenyl]-1-methyl-3-propyl-4H-pyrazolo[4,3-d]pyrimidin-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | Acetildenafil is a derivative of the phosphodiesterase 5 (PDE5) inhibitor Sildenafil. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Melting Point | 131-133ºC |
| Molecular Formula | C25H34N6O3 |
| Molecular Weight | 466.576 |
| Exact Mass | 466.269226 |
| PSA | 96.35000 |
| LogP | 2.03 |
| Index of Refraction | 1.637 |
| InChIKey | RRBRQNALHKQCAI-UHFFFAOYSA-N |
| SMILES | CCCc1nn(C)c2c(=O)[nH]c(-c3cc(C(=O)CN4CCN(CC)CC4)ccc3OCC)nc12 |
| 5-[2-Ethoxy-5-[2-(4-ethyl-1-piperazinyl)acetyl]phenyl]-1,6-dihydro-1-methyl-3-propyl-7H-pyrazolo[4,3-d]pyrimidin-7-one |
| 5-{2-Ethoxy-5-[(4-ethyl-1-piperazinyl)acetyl]phenyl}-1-methyl-3-propyl-1,6-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one |
| 7H-Pyrazolo[4,3-d]pyrimidin-7-one, 5-[2-ethoxy-5-[2-(4-ethyl-1-piperazinyl)acetyl]phenyl]-1,6-dihydro-1-methyl-3-propyl- |
| Hongdenafil |
| 5-{2-Ethoxy-5-[(4-ethyl-1-piperazinyl)acetyl]phenyl}-1-methyl-3-propyl-1,4-dihydro-7H-pyrazolo[4,3-d]pyrimidin-7-one |
| Acetildenafil |