prop-2-enyl 2,2-dimethyl-3-oxononanoate
prop-2-enyl 2,2-dimethyl-3-oxononanoate structure
|
Common Name | prop-2-enyl 2,2-dimethyl-3-oxononanoate | ||
|---|---|---|---|---|
| CAS Number | 83135-37-9 | Molecular Weight | 240.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: prop-2-enyl 2,2-dimethyl-3-oxononanoate (CAS number: 83135-37-9, molecular formula: C14H24O3, molecular weight: 240.33900) For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | prop-2-enyl 2,2-dimethyl-3-oxononanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H24O3 |
|---|---|
| Molecular Weight | 240.33900 |
| Exact Mass | 240.17300 |
| PSA | 43.37000 |
| LogP | 3.28130 |
| InChIKey | LJPATZPLUMMKCJ-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C(C)(C)C(=O)CCCCCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~79%
prop-2-enyl 2,2... CAS#:83135-37-9 |
| Literature: Tsuji, Jiro; Nisar, Mohammad; Shimizu, Isao Journal of Organic Chemistry, 1985 , vol. 50, # 18 p. 3416 - 3417 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:51756-19-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Nonanoic acid,2,2-dimethyl-3-oxo-,2-propenyl ester |
| allyl 3-oxo-2,2-dimethylnonanoate |
| allyl 2-methyl-2-heptanylpropanoate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of prop-2-enyl 2,2-dimethyl-3-oxononanoate? |
| A: Polar surface area (PSA) of prop-2-enyl 2,2-dimethyl-3-oxononanoate is 43.37000. |
| Q: What is the SMILES notation of prop-2-enyl 2,2-dimethyl-3-oxononanoate? |
| A: SMILES notation of prop-2-enyl 2,2-dimethyl-3-oxononanoate is C=CCOC(=O)C(C)(C)C(=O)CCCCCC. |
| Q: What is the molecular formula of prop-2-enyl 2,2-dimethyl-3-oxononanoate? |
| A: Molecular formula of prop-2-enyl 2,2-dimethyl-3-oxononanoate is C14H24O3. |
| Q: What is the LogP of prop-2-enyl 2,2-dimethyl-3-oxononanoate? |
| A: LogP of prop-2-enyl 2,2-dimethyl-3-oxononanoate is 3.28130. |
| Q: What is the CAS number of prop-2-enyl 2,2-dimethyl-3-oxononanoate? |
| A: CAS number of prop-2-enyl 2,2-dimethyl-3-oxononanoate is 83135-37-9. |
| Q: What is the molecular weight of prop-2-enyl 2,2-dimethyl-3-oxononanoate? |
| A: Molecular weight of prop-2-enyl 2,2-dimethyl-3-oxononanoate is 240.33900. |
| Q: What are the upstream materials of prop-2-enyl 2,2-dimethyl-3-oxononanoate? |
| A: Related upstream materials(CAS) of prop-2-enyl 2,2-dimethyl-3-oxononanoate: 74-88-4. |
| Q: What English synonyms does prop-2-enyl 2,2-dimethyl-3-oxononanoate have? |
| A: English synonyms of prop-2-enyl 2,2-dimethyl-3-oxononanoate: Nonanoic acid,2,2-dimethyl-3-oxo-,2-propenyl ester, allyl 3-oxo-2,2-dimethylnonanoate, allyl 2-methyl-2-heptanylpropanoate. |
| Q: What are the downstream products of prop-2-enyl 2,2-dimethyl-3-oxononanoate? |
| A: Related downstream products(CAS) of prop-2-enyl 2,2-dimethyl-3-oxononanoate: 51756-19-5. |
| Q: What is the Chinese name of 83135-37-9? |
| A: Chinese name of 83135-37-9 is 83135-37-9. |