3-(N,N-Dimethylaminocarbonyl)phenylboronic acid pinacol ester structure
|
Common Name | 3-(N,N-Dimethylaminocarbonyl)phenylboronic acid pinacol ester | ||
|---|---|---|---|---|
| CAS Number | 832114-07-5 | Molecular Weight | 275.15100 | |
| Density | N/A | Boiling Point | 416.1℃ at 760 mmHg | |
| Molecular Formula | C15H22BNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.4℃ | |
| Name | N,N-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 416.1℃ at 760 mmHg |
|---|---|
| Molecular Formula | C15H22BNO3 |
| Molecular Weight | 275.15100 |
| Flash Point | 205.4℃ |
| Exact Mass | 275.16900 |
| PSA | 38.77000 |
| LogP | 1.68760 |
| InChIKey | CHLGBYJEMLCJJJ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)c1cccc(B2OC(C)(C)C(C)(C)O2)c1 |
| Storage condition | 2-8℃ |
|
~%
3-(N,N-Dimethyl... CAS#:832114-07-5
Detail
|
| Literature: Cho; Iverson; Smith III Journal of the American Chemical Society, 2000 , vol. 122, # 51 p. 12868 - 12869 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N,N-Dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolane-2-yl)benzamide |
| 3-(dimethylcarbamoyl)benzeneboronic acid,pinacol ester |
| 3-(N,N-Dimethylaminocarbonyl)phenylboronic acid pinacol ester |