6-methoxy-5-nitroquinoline-2-carbothioamide structure
|
Common Name | 6-methoxy-5-nitroquinoline-2-carbothioamide | ||
|---|---|---|---|---|
| CAS Number | 83220-10-4 | Molecular Weight | 263.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H9N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methoxy-5-nitroquinoline-2-carbothioamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H9N3O3S |
|---|---|
| Molecular Weight | 263.27200 |
| Exact Mass | 263.03600 |
| PSA | 126.05000 |
| LogP | 3.00930 |
| InChIKey | MEVUEOUPHLKSNA-UHFFFAOYSA-N |
| SMILES | COc1ccc2nc(C(N)=S)ccc2c1[N+](=O)[O-] |
|
~89%
6-methoxy-5-nit... CAS#:83220-10-4 |
| Literature: Boger,D.L.; Panek,J.S. Journal of the American Chemical Society, 1985 , vol. 107, p. 5745 |
|
~%
6-methoxy-5-nit... CAS#:83220-10-4 |
| Literature: Boger,D.L.; Panek,J.S. Journal of the American Chemical Society, 1985 , vol. 107, p. 5745 |
|
~%
6-methoxy-5-nit... CAS#:83220-10-4 |
| Literature: Boger,D.L.; Panek,J.S. Journal of the American Chemical Society, 1985 , vol. 107, p. 5745 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Quinolinecarbothioamide,6-methoxy-5-nitro |