5-(4-METHYLPHENYL)-5-OXOVALERIC ACID
5-(4-METHYLPHENYL)-5-OXOVALERIC ACID structure
|
Common Name | 5-(4-METHYLPHENYL)-5-OXOVALERIC ACID | ||
|---|---|---|---|---|
| CAS Number | 833-85-2 | Molecular Weight | 206.23800 | |
| Density | 1.137g/cm3 | Boiling Point | 399.5ºC at 760 mmHg | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.6ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(4-methylphenyl)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 399.5ºC at 760 mmHg |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.23800 |
| Flash Point | 209.6ºC |
| Exact Mass | 206.09400 |
| PSA | 54.37000 |
| LogP | 2.43260 |
| Index of Refraction | 1.536 |
| InChIKey | MCWLCBLXRSXGTF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CCCC(=O)O)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918300090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 2 | |
CAS#:42482-94-0
CAS#:108-55-4
CAS#:108-88-3
CAS#:4294-57-9
CAS#:5205-39-0
CAS#:827-56-5
CAS#:120-92-3
CAS#:122-00-9
CAS#:777-93-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-(4-Methylphenyl)-5-oxovaleric acid |
| p-toluoylbutyric acid |
| 5-oxo-5-p-tolyl-valeric acid |
| 4-benzoylbutyric acid |
| 4-(4-methylbenzoyl)butyric acid |
| 4-p-Toluoylbutyric acid |
| 5-Oxo-5-p-tolyl-pentanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 5-(4-methylphenyl)-5-oxopentanoic acid? |
| A: The English name of 5-(4-methylphenyl)-5-oxopentanoic acid is 5-(4-methylphenyl)-5-oxopentanoic acid. |
| Q: What is the LogP of 5-(4-methylphenyl)-5-oxopentanoic acid? |
| A: LogP of 5-(4-methylphenyl)-5-oxopentanoic acid is 2.43260. |
| Q: What is the polar surface area (PSA) of 5-(4-methylphenyl)-5-oxopentanoic acid? |
| A: Polar surface area (PSA) of 5-(4-methylphenyl)-5-oxopentanoic acid is 54.37000. |
| Q: What are the upstream materials of 5-(4-methylphenyl)-5-oxopentanoic acid? |
| A: Related upstream materials(CAS) of 5-(4-methylphenyl)-5-oxopentanoic acid: 42482-94-0;108-55-4;108-88-3;4294-57-9;5205-39-0;827-56-5;120-92-3;122-00-9. |
| Q: What English synonyms does 5-(4-methylphenyl)-5-oxopentanoic acid have? |
| A: English synonyms of 5-(4-methylphenyl)-5-oxopentanoic acid: 5-(4-Methylphenyl)-5-oxovaleric acid, p-toluoylbutyric acid, 5-oxo-5-p-tolyl-valeric acid, 4-benzoylbutyric acid, 4-(4-methylbenzoyl)butyric acid, 4-p-Toluoylbutyric acid, 5-Oxo-5-p-tolyl-pentanoic acid. |
| Q: What is the SMILES notation of 5-(4-methylphenyl)-5-oxopentanoic acid? |
| A: SMILES notation of 5-(4-methylphenyl)-5-oxopentanoic acid is Cc1ccc(C(=O)CCCC(=O)O)cc1. |
| Q: What are the downstream products of 5-(4-methylphenyl)-5-oxopentanoic acid? |
| A: Related downstream products(CAS) of 5-(4-methylphenyl)-5-oxopentanoic acid: 42482-94-0;777-93-5. |
| Q: What is the molecular weight of 5-(4-methylphenyl)-5-oxopentanoic acid? |
| A: Molecular weight of 5-(4-methylphenyl)-5-oxopentanoic acid is 206.23800. |
| Q: What is the boiling point of 5-(4-methylphenyl)-5-oxopentanoic acid? |
| A: Boiling point of 5-(4-methylphenyl)-5-oxopentanoic acid is 399.5ºC at 760 mmHg. |
| Q: What is the CAS number of 5-(4-methylphenyl)-5-oxopentanoic acid? |
| A: CAS number of 5-(4-methylphenyl)-5-oxopentanoic acid is 833-85-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |