4,4,5,5,6,6,7,7,7-Nonafluoroheptan-1-ol structure
|
Common Name | 4,4,5,5,6,6,7,7,7-Nonafluoroheptan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 83310-97-8 | Molecular Weight | 278.11600 | |
| Density | 1.528 g/mL at 25 °C(lit.) | Boiling Point | 163-164 °C(lit.) | |
| Molecular Formula | C7H7F9O | Melting Point | -60--55℃ | |
| MSDS | Chinese USA | Flash Point | 170 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-(Perfluorobutyl)propanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.528 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 163-164 °C(lit.) |
| Melting Point | -60--55℃ |
| Molecular Formula | C7H7F9O |
| Molecular Weight | 278.11600 |
| Flash Point | 170 °F |
| Exact Mass | 278.03500 |
| PSA | 20.23000 |
| LogP | 3.22710 |
| Index of Refraction | n20/D 1.327(lit.) |
| InChIKey | OVBNEUIFHDEQHD-UHFFFAOYSA-N |
| SMILES | OCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| HS Code | 2905590090 |
|
~82%
4,4,5,5,6,6,7,7... CAS#:83310-97-8 |
| Literature: Rabai, Jozsef; Szijjarto, Csongor; Ivanko, Peter; Szabo, Denes Synthesis, 2007 , # 16 p. 2581 - 2584 |
|
~99%
4,4,5,5,6,6,7,7... CAS#:83310-97-8 |
| Literature: Chugai Seiyaku Kabushiki Kaisha Patent: US6552069 B1, 2003 ; |
|
~%
4,4,5,5,6,6,7,7... CAS#:83310-97-8 |
| Literature: Journal of Fluorine Chemistry, , vol. 20, p. 313 - 328 |
| HS Code | 2905590090 |
|---|---|
| Summary | 2905590090 other halogenated, sulphonated, nitrated or nitrosated derivatives of acyclic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| MFCD02183552 |
| 4,4,5,5,6,6,7,7,7-nonafluoroheptan-1-ol |