[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol
![[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol Structure](https://image.chemsrc.com/caspic/211/833451-97-1.png)
[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol structure
|
Common Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 833451-97-1 | Molecular Weight | 379.11600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9F3INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H9F3INO |
|---|---|
| Molecular Weight | 379.11600 |
| Exact Mass | 378.96800 |
| PSA | 32.26000 |
| LogP | 4.01740 |
| InChIKey | IDHXMRISFLCDAF-UHFFFAOYSA-N |
| SMILES | OCc1ccc(F)c(F)c1Nc1ccc(I)cc1F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~74%
[3,4-difluoro-2... CAS#:833451-97-1 |
| Literature: WARNER-LAMBERT COMPANY LLC Patent: WO2005/7616 A1, 2005 ; Location in patent: Page/Page column 23 ; WO 2005/007616 A1 |
|
~56%
[3,4-difluoro-2... CAS#:833451-97-1 |
| Literature: Rezvani, Z. Nooshin; Mayer, R. John; Chan, Weng C. Chemical Communications, 2010 , vol. 46, # 12 p. 2043 - 2045 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:833451-98-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol? |
| A: CAS number of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol is 833451-97-1. |
| Q: What is the SMILES notation of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol? |
| A: SMILES notation of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol is OCc1ccc(F)c(F)c1Nc1ccc(I)cc1F. |
| Q: What are the upstream materials of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol? |
| A: Related upstream materials(CAS) of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol: 391211-97-5;1228151-09-4. |
| Q: What are the downstream products of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol? |
| A: Related downstream products(CAS) of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol: 833451-98-2. |
| Q: What is the molecular weight of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol? |
| A: Molecular weight of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol is 379.11600. |
| Q: What is the English name of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol? |
| A: The English name of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol is [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol. |
| Q: What is the InChIKey of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol? |
| A: InChIKey of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol is IDHXMRISFLCDAF-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 833451-97-1? |
| A: Chinese name of 833451-97-1 is 833451-97-1. |
| Q: What is the molecular formula of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol? |
| A: Molecular formula of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol is C13H9F3INO. |
| Q: What is the LogP of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol? |
| A: LogP of [3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol is 4.01740. |