3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde
3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde structure
|
Common Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 833451-98-2 | Molecular Weight | 377.10000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7F3INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H7F3INO |
|---|---|
| Molecular Weight | 377.10000 |
| Exact Mass | 376.95200 |
| PSA | 29.10000 |
| LogP | 4.33760 |
| InChIKey | AXYCSECLQNXJGF-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(F)c(F)c1Nc1ccc(I)cc1F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~85%
3,4-difluoro-2-... CAS#:833451-98-2 |
| Literature: WARNER-LAMBERT COMPANY LLC Patent: WO2005/7616 A1, 2005 ; Location in patent: Page/Page column 23-24 ; WO 2005/007616 A1 |
![[3,4-difluoro-2-(2-fluoro-4-iodoanilino)phenyl]methanol structure](https://image.chemsrc.com/caspic/211/833451-97-1.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:833451-99-3This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde? |
| A: Related downstream products(CAS) of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde: 833451-99-3. |
| Q: What is the molecular weight of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde? |
| A: Molecular weight of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde is 377.10000. |
| Q: What is the English name of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde? |
| A: The English name of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde is 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde. |
| Q: What are the upstream materials of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde? |
| A: Related upstream materials(CAS) of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde: 833451-97-1. |
| Q: What is the molecular formula of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde? |
| A: Molecular formula of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde is C13H7F3INO. |
| Q: What is the InChIKey of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde? |
| A: InChIKey of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde is AXYCSECLQNXJGF-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde? |
| A: Polar surface area (PSA) of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde is 29.10000. |
| Q: What is the LogP of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde? |
| A: LogP of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde is 4.33760. |
| Q: What is the SMILES notation of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde? |
| A: SMILES notation of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde is O=Cc1ccc(F)c(F)c1Nc1ccc(I)cc1F. |
| Q: What is the CAS number of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde? |
| A: CAS number of 3,4-difluoro-2-(2-fluoro-4-iodoanilino)benzaldehyde is 833451-98-2. |