Ebracteolata cpd B structure
|
Common Name | Ebracteolata cpd B | ||
|---|---|---|---|---|
| CAS Number | 83459-37-4 | Molecular Weight | 196.200 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 355.5±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H12O4 | Melting Point | 224℃ | |
| MSDS | N/A | Flash Point | 141.5±15.8 °C | |
Use of Ebracteolata cpd BEbracteolata cpd B is a natural phenol compound found in Euphorbia ebracteolata[1]. |
| Name | 2,4-dihydroxy-6-methoxy-3-methylacetophenone |
|---|---|
| Synonym | More Synonyms |
| Description | Ebracteolata cpd B is a natural phenol compound found in Euphorbia ebracteolata[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.5±22.0 °C at 760 mmHg |
| Melting Point | 224℃ |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.200 |
| Flash Point | 141.5±15.8 °C |
| Exact Mass | 196.073563 |
| PSA | 66.76000 |
| LogP | 2.65 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | RFKMWWMZUHXFBA-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c(C)c(O)c1C(C)=O |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 1-(2,4-Dihydroxy-6-methoxy-3-methylphenyl)ethanone |
| 2,4-Dihydroxy-6-methoxy-3-methylacetophenone |
| Ethanone, 1-(2,4-dihydroxy-6-methoxy-3-methylphenyl)- |
| 1-(2,4-Dihydroxy-6-methoxy-3-methyl-phenyl)-aethanon |
| 1-(2,4-dihydroxy-6-methoxy-3-methyl-phenyl)-ethanone |