(R)-N-METHYL-1-(4-FLUOROPHENYL)ETHYLAMINE structure
|
Common Name | (R)-N-METHYL-1-(4-FLUOROPHENYL)ETHYLAMINE | ||
|---|---|---|---|---|
| CAS Number | 83461-40-9 | Molecular Weight | 210.24800 | |
| Density | 1.207g/cm3 | Boiling Point | 322.4ºC at 760 mmHg | |
| Molecular Formula | C7H14O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.8ºC | |
| Name | [(4R)-2,2-Dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 322.4ºC at 760 mmHg |
| Molecular Formula | C7H14O5S |
| Molecular Weight | 210.24800 |
| Flash Point | 148.8ºC |
| Exact Mass | 210.05600 |
| PSA | 70.21000 |
| LogP | 1.19490 |
| Index of Refraction | 1.445 |
| InChIKey | YGNUPHMVMXPKGU-ZCFIWIBFSA-N |
| SMILES | CC1(C)OCC(COS(C)(=O)=O)O1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Methoxymethymethylsulfoxid |
| methylsulfonic acid |
| formaldehyde dimethylthioacetal S-oxide |
| triflic acid |
| Methoxymethyl-methyl-sulfoxid |
| methoxymethyl methyl sulfoxide |
| mesylic acid |
| methanesulfinyl-methoxy-methane |
| methylsulfinyl-methoxy-methane |