(S)-N-METHYL-1-(4-FLUOROPHENYL)ETHYLAMINE structure
|
Common Name | (S)-N-METHYL-1-(4-FLUOROPHENYL)ETHYLAMINE | ||
|---|---|---|---|---|
| CAS Number | 90129-42-3 | Molecular Weight | 210.24800 | |
| Density | 1.207g/cm3 | Boiling Point | 322.4ºC at 760 mmHg | |
| Molecular Formula | C7H14O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.8ºC | |
| Name | [(4S)-2,2-Dimethyl-1,3-dioxolan-4-yl]methyl methanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.207g/cm3 |
|---|---|
| Boiling Point | 322.4ºC at 760 mmHg |
| Molecular Formula | C7H14O5S |
| Molecular Weight | 210.24800 |
| Flash Point | 148.8ºC |
| Exact Mass | 210.05600 |
| PSA | 70.21000 |
| LogP | 1.19490 |
| Index of Refraction | 1.445 |
| InChIKey | YGNUPHMVMXPKGU-LURJTMIESA-N |
| SMILES | CC1(C)OCC(COS(C)(=O)=O)O1 |
|
~%
(S)-N-METHYL-1-... CAS#:90129-42-3 |
| Literature: Le Huerou, Yvan; Doyon, Julien; Gree, Rene L. Journal of Organic Chemistry, 1999 , vol. 64, # 18 p. 6782 - 6790 |
|
~%
(S)-N-METHYL-1-... CAS#:90129-42-3 |
| Literature: INDUSTRIAL RESEARCH LIMITED; ALBERT EINSTEIN COLLEGE OF MEDICINE OF YESHIVA UNIVERSITY Patent: WO2008/30119 A1, 2008 ; Location in patent: Page/Page column 26 ; WO 2008/030119 A1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| (2S)-2,2-dimethyl-1,3-dioxolane-4-methanol methanesulfonate |
| (S)-1-mesiloxy-2,3-propanediol acetonide |
| (S)-1-mesyloxy-2,3-propanediol acetonide |
| (S)-(2,2-dimethyl-1,3-dioxolan-4-yl)methyl methanesulfonate |
| (4S)-methanesulfonic acid 2,2-dimethyl-[1,3]dioxolan-4-ylmethyl ester |
| 1,3-Dioxolane-4-methanol,2,2-dimethyl-,methanesulfonate,(4S) |