2-Chloro-N-(2-methyl-4-nitro-phenyl)acetamide structure
|
Common Name | 2-Chloro-N-(2-methyl-4-nitro-phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 83473-10-3 | Molecular Weight | 228.63200 | |
| Density | 1.411g/cm3 | Boiling Point | 424.2ºC at 760 mmHg | |
| Molecular Formula | C9H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.4ºC | |
| Name | 2-chloro-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.411g/cm3 |
|---|---|
| Boiling Point | 424.2ºC at 760 mmHg |
| Molecular Formula | C9H9ClN2O3 |
| Molecular Weight | 228.63200 |
| Flash Point | 210.4ºC |
| Exact Mass | 228.03000 |
| PSA | 74.92000 |
| LogP | 2.67670 |
| Index of Refraction | 1.617 |
| InChIKey | SWSWELOJKQQJGV-UHFFFAOYSA-N |
| SMILES | Cc1cc([N+](=O)[O-])ccc1NC(=O)CCl |
| HS Code | 2924299090 |
|---|
|
~88%
2-Chloro-N-(2-m... CAS#:83473-10-3 |
| Literature: Swelam; Fawzy Egyptian Journal of Chemistry, 2004 , vol. 47, # 5 p. 565 - 577 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-Nitro-2-chloracetamino-toluol |