Benzenemethanol, α-ethynyl-3-nitro- structure
|
Common Name | Benzenemethanol, α-ethynyl-3-nitro- | ||
|---|---|---|---|---|
| CAS Number | 83494-25-1 | Molecular Weight | 177.15700 | |
| Density | 1.335g/cm3 | Boiling Point | 293.1ºC at 760mmHg | |
| Molecular Formula | C9H7NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.9ºC | |
| Name | 1-(3-nitrophenyl)prop-2-yn-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.335g/cm3 |
|---|---|
| Boiling Point | 293.1ºC at 760mmHg |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.15700 |
| Flash Point | 128.9ºC |
| Exact Mass | 177.04300 |
| PSA | 66.05000 |
| LogP | 1.78460 |
| Index of Refraction | 1.616 |
| InChIKey | WACRSIOBIWTUMX-UHFFFAOYSA-N |
| SMILES | C#CC(O)c1cccc([N+](=O)[O-])c1 |
|
~%
Benzenemethanol... CAS#:83494-25-1 |
| Literature: Pigge, F. Christopher; Ghasedi, Fatemeh; Zheng, Zhanmiao; Rath, Nigam P.; Nichols, Gary; Chickos, James S. Journal of the Chemical Society. Perkin Transactions 2, 2000 , # 12 p. 2458 - 2464 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzenemethanol,|A-ethynyl-3-nitro |