3-[(3-chloroanilino)methylidene]pentane-2,4-dione structure
|
Common Name | 3-[(3-chloroanilino)methylidene]pentane-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 83507-74-8 | Molecular Weight | 237.68200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[(3-chloroanilino)methylidene]pentane-2,4-dione |
|---|
| Molecular Formula | C12H12ClNO2 |
|---|---|
| Molecular Weight | 237.68200 |
| Exact Mass | 237.05600 |
| PSA | 46.17000 |
| LogP | 2.88680 |
| InChIKey | NIDFAOQNOXNGFB-ODOBQZIKSA-N |
| SMILES | CC(=O)C(C=Nc1cccc(Cl)c1)=C(C)O |
|
~%
3-[(3-chloroani... CAS#:83507-74-8 |
| Literature: Snyder; Jones Journal of the American Chemical Society, 1946 , vol. 68, p. 1253 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |