5-Bromo-2-phenyl-1H-indole structure
|
Common Name | 5-Bromo-2-phenyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 83515-06-4 | Molecular Weight | 272.140 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 442.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H10BrN | Melting Point | 195-196ºC | |
| MSDS | N/A | Flash Point | 221.3±23.2 °C | |
| Name | 5-bromo-2-phenyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 442.3±25.0 °C at 760 mmHg |
| Melting Point | 195-196ºC |
| Molecular Formula | C14H10BrN |
| Molecular Weight | 272.140 |
| Flash Point | 221.3±23.2 °C |
| Exact Mass | 270.999664 |
| PSA | 15.79000 |
| LogP | 5.53 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.699 |
| InChIKey | XGOWHPSXPPZWAH-UHFFFAOYSA-N |
| SMILES | Brc1ccc2[nH]c(-c3ccccc3)cc2c1 |
| HS Code | 2933990090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole, 5-bromo-2-phenyl- |
| 5-bromo-2-phenyl-indole |
| 1H-INDOLE,5-BROMO-2-PHENYL |
| 5-brom-2-phenyl-1H-indole |
| 5-Bromo-2-phenyl-1H-indole |