2-Butenoic acid,4-[[4-[[(carboxymethyl)amino]carbonyl]phenyl]amino]-4-oxo-, (Z)- (9CI) structure
|
Common Name | 2-Butenoic acid,4-[[4-[[(carboxymethyl)amino]carbonyl]phenyl]amino]-4-oxo-, (Z)- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 83560-90-1 | Molecular Weight | 292.24400 | |
| Density | 1.496g/cm3 | Boiling Point | 705.7ºC at 760 mmHg | |
| Molecular Formula | C13H12N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 380.6ºC | |
| Name | 4-[4-(carboxymethylcarbamoyl)anilino]-4-oxobut-2-enoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.496g/cm3 |
|---|---|
| Boiling Point | 705.7ºC at 760 mmHg |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.24400 |
| Flash Point | 380.6ºC |
| Exact Mass | 292.07000 |
| PSA | 132.80000 |
| LogP | 0.54420 |
| Index of Refraction | 1.65 |
| InChIKey | LXWLHBPEOKDYLU-WAYWQWQTSA-N |
| SMILES | O=C(O)C=CC(=O)Nc1ccc(C(=O)NCC(=O)O)cc1 |
| HS Code | 2924299090 |
|---|
|
~99%
2-Butenoic acid... CAS#:83560-90-1 |
| Literature: Koechel; Tarloff; Rankin Journal of Medicinal Chemistry, 1983 , vol. 26, # 1 p. 85 - 90 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Mal-Pab-Gly |
| 4-maleamidohippuric acid |