n-fluoroperfluoropiperidine structure
|
Common Name | n-fluoroperfluoropiperidine | ||
|---|---|---|---|---|
| CAS Number | 836-77-1 | Molecular Weight | 283.04300 | |
| Density | 1.78g/cm3 | Boiling Point | 52.7ºC at 760 mmHg | |
| Molecular Formula | C5F11N | Melting Point | 174-176 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,2,2,3,3,4,4,5,5,6,6-undecafluoropiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.78g/cm3 |
|---|---|
| Boiling Point | 52.7ºC at 760 mmHg |
| Melting Point | 174-176 °C |
| Molecular Formula | C5F11N |
| Molecular Weight | 283.04300 |
| Exact Mass | 282.98600 |
| PSA | 3.24000 |
| LogP | 3.21590 |
| Index of Refraction | 1.285 |
| InChIKey | VCEAGMYKGZNUFL-UHFFFAOYSA-N |
| SMILES | FN1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Undecafluor-piperidin |
| undecafluoro-piperidine |
| Piperidine undecafluoro-,dimer |
| N-fluoroperfluoropiperidine |
| MFCD00077545 |
| perfluoro-N-fluoropiperidine |
| Piperidine,undecafluoro |