N-(4-(((2-((2-(((4-(Acetylamino)phenyl)sulfonyl)amino)ethyl)dithio)ethyl)amino)sulfonyl)phenyl)acetamide structure
|
Common Name | N-(4-(((2-((2-(((4-(Acetylamino)phenyl)sulfonyl)amino)ethyl)dithio)ethyl)amino)sulfonyl)phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 83626-62-4 | Molecular Weight | 546.70400 | |
| Density | 1.443g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H26N4O6S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[4-[2-[2-[(4-acetamidophenyl)sulfonylamino]ethyldisulfanyl]ethylsulfamoyl]phenyl]acetamide |
|---|
| Density | 1.443g/cm3 |
|---|---|
| Molecular Formula | C20H26N4O6S4 |
| Molecular Weight | 546.70400 |
| Exact Mass | 546.07400 |
| PSA | 217.90000 |
| LogP | 5.33100 |
| Index of Refraction | 1.643 |
| InChIKey | TXEHMVXZQGKSAO-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)NCCSSCCNS(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
|
~90%
N-(4-(((2-((2-(... CAS#:83626-62-4 |
| Literature: Foye; Kauffman; Suttimool Journal of Pharmaceutical Sciences, 1982 , vol. 71, # 7 p. 799 - 802 |
|
~%
N-(4-(((2-((2-(... CAS#:83626-62-4 |
| Literature: Lehmann; Grivsky Bulletin des Societes Chimiques Belges, 1946 , vol. 55, p. 52,55, 75 |
| Precursor 3 | |
|---|---|
| DownStream 1 | |