DHPS structure
|
Common Name | DHPS | ||
|---|---|---|---|---|
| CAS Number | 83626-67-9 | Molecular Weight | 462.63000 | |
| Density | 1.459g/cm3 | Boiling Point | 716.1ºC at 760 mmHg | |
| Molecular Formula | C16H22N4O4S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 386.9ºC | |
| Name | 4-amino-N-[2-[2-[(4-aminophenyl)sulfonylamino]ethyldisulfanyl]ethyl]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.459g/cm3 |
|---|---|
| Boiling Point | 716.1ºC at 760 mmHg |
| Molecular Formula | C16H22N4O4S4 |
| Molecular Weight | 462.63000 |
| Flash Point | 386.9ºC |
| Exact Mass | 462.05200 |
| PSA | 211.74000 |
| LogP | 5.59500 |
| Index of Refraction | 1.668 |
| InChIKey | BZLNVVPROHZNJT-UHFFFAOYSA-N |
| SMILES | Nc1ccc(S(=O)(=O)NCCSSCCNS(=O)(=O)c2ccc(N)cc2)cc1 |
|
~%
DHPS CAS#:83626-67-9 |
| Literature: Foye; Kauffman; Suttimool Journal of Pharmaceutical Sciences, 1982 , vol. 71, # 7 p. 799 - 802 |
|
~%
DHPS CAS#:83626-67-9 |
| Literature: Foye; Kauffman; Suttimool Journal of Pharmaceutical Sciences, 1982 , vol. 71, # 7 p. 799 - 802 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| bis-(2-sulfanilylamino-ethyl)-disulfide |
| Bis-(2-sulfanilylamino-aethyl)-disulfid |
| 4-Amino-N-(2-((2-(((4-aminophenyl)sulfonyl)amino)ethyl)dithio)ethyl)benzenesulfonamide |