7-methoxy-1,2-dimethyl-2,3,4,9-tetrahydro-1H-β-carboline structure
|
Common Name | 7-methoxy-1,2-dimethyl-2,3,4,9-tetrahydro-1H-β-carboline | ||
|---|---|---|---|---|
| CAS Number | 837-75-2 | Molecular Weight | 230.30600 | |
| Density | 1.13g/cm3 | Boiling Point | 378.6ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.8ºC | |
| Name | 7-methoxy-1,2-dimethyl-2,3,4,9-tetrahydro-1H-β-carboline |
|---|
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 378.6ºC at 760 mmHg |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.30600 |
| Flash Point | 182.8ºC |
| Exact Mass | 230.14200 |
| PSA | 28.26000 |
| LogP | 2.66330 |
| Index of Refraction | 1.607 |
| InChIKey | XESCOJFEJCDSFL-UHFFFAOYSA-N |
| SMILES | COc1ccc2c3c([nH]c2c1)C(C)N(C)CC3 |
|
~%
7-methoxy-1,2-d... CAS#:837-75-2 |
| Literature: Rubzow et al. Zhurnal Obshchei Khimii, 1959 , vol. 29, p. 3268,3270; engl. Ausg. S. 3232, 3233 |
|
~%
7-methoxy-1,2-d... CAS#:837-75-2 |
| Literature: Perkin; Robinson Journal of the Chemical Society, 1919 , vol. 115, p. 939 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |